CymitQuimica logo

CAS 1186608-83-2

:

3-Bromo-5-nitro-1H-pyrazolo[3,4-b]pyridine

Description:
3-Bromo-5-nitro-1H-pyrazolo[3,4-b]pyridine is a heterocyclic compound characterized by the presence of both bromine and nitro functional groups attached to a pyrazolo-pyridine framework. This compound features a fused bicyclic structure, which contributes to its unique chemical properties and potential biological activity. The bromine atom typically enhances the compound's reactivity, making it suitable for various substitution reactions, while the nitro group can influence its electronic properties and solubility. The presence of these functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the compound's structural features may impart interesting optical or electronic properties, making it a candidate for research in materials science. Its CAS number, 1186608-83-2, allows for easy identification and retrieval of information regarding its synthesis, safety data, and potential applications in scientific literature. Overall, 3-Bromo-5-nitro-1H-pyrazolo[3,4-b]pyridine is a compound of interest in both organic synthesis and drug discovery.
Formula:C6H3BrN4O2
InChI:InChI=1S/C6H3BrN4O2/c7-5-4-1-3(11(12)13)2-8-6(4)10-9-5/h1-2H,(H,8,9,10)
InChI key:KUKTUBBDMTVCMV-UHFFFAOYSA-N
SMILES:C1=C(C=NC2=NNC(=C21)Br)[N+](=O)[O-]
Synonyms:
  • 3-bromo-5-nitro-2H-pyrazolo[3,4-b]pyridine
  • 1H-Pyrazolo[3,4-b]pyridine, 3-bromo-5-nitro-
Found 5 products.