CymitQuimica logo

CAS 1186663-49-9

:

2-Methyl-3-(methylsulfonyl)benzoic acid

Description:
2-Methyl-3-(methylsulfonyl)benzoic acid is an organic compound characterized by its benzoic acid structure, which includes a methyl group and a methylsulfonyl group attached to the aromatic ring. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the methylsulfonyl group enhances its solubility in polar solvents and may influence its reactivity and biological activity. Typically, compounds like this can exhibit moderate to high melting points due to the presence of hydrogen bonding capabilities from the carboxylic acid group. Additionally, the methylsulfonyl group can impart unique properties, such as increased stability and potential for various chemical reactions, including nucleophilic substitutions. This compound may also be of interest in pharmaceutical applications, as derivatives of benzoic acid are often explored for their therapeutic potential. Overall, 2-Methyl-3-(methylsulfonyl)benzoic acid is a versatile compound with significant implications in both synthetic chemistry and medicinal chemistry.
Formula:C9H10O4S
InChI:InChI=1S/C9H10O4S/c1-6-7(9(10)11)4-3-5-8(6)14(2,12)13/h3-5H,1-2H3,(H,10,11)
InChI key:InChIKey=WMALKKDIJHZYRM-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(C)C(C(O)=O)=CC=C1
Synonyms:
  • 3-Methanesulfonyl-2-methylbenzoic acid
  • 2-Methyl-3-(methylsulfonyl)benzoic acid
  • Benzoic acid, 2-methyl-3-(methylsulfonyl)-
Found 3 products.