CymitQuimica logo

CAS 118688-53-2

:

1,3,5-Tris(p-formylphenyl)benzene

Description:
1,3,5-Tris(p-formylphenyl)benzene is an organic compound characterized by its structure, which features a central benzene ring substituted with three p-formylphenyl groups. This compound belongs to the class of triaryl compounds and is notable for its potential applications in materials science, particularly in the synthesis of polymers and coordination complexes. The presence of formyl groups (-CHO) contributes to its reactivity, allowing for further functionalization and polymerization. It is typically a solid at room temperature and may exhibit properties such as solubility in organic solvents, depending on the specific solvent and conditions. The compound's molecular structure can lead to interesting optical and electronic properties, making it a subject of interest in organic electronics and photonics. Additionally, its synthesis often involves multi-step organic reactions, highlighting its relevance in synthetic organic chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C27H18O3
InChI:InChI=1S/C27H18O3/c28-16-19-1-7-22(8-2-19)25-13-26(23-9-3-20(17-29)4-10-23)15-27(14-25)24-11-5-21(18-30)6-12-24/h1-18H
InChI key:ZCJZVMNBJKPQEV-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C=O)C2=CC(=CC(=C2)C3=CC=C(C=C3)C=O)C4=CC=C(C=C4)C=O
Synonyms:
  • 1,4-Di-(p-benzaldehydyl)-naphthalene
Found 6 products.