CymitQuimica logo

CAS 1187163-84-3

:

(3,4-Difluorophenyl)(4-methyl-3-pyridinyl)methanone

Description:
(3,4-Difluorophenyl)(4-methyl-3-pyridinyl)methanone, identified by its CAS number 1187163-84-3, is a chemical compound characterized by its unique structural features. It consists of a difluorophenyl group and a pyridinyl moiety, which contribute to its potential biological activity and chemical reactivity. The presence of fluorine atoms enhances the compound's lipophilicity and may influence its interaction with biological targets. The methanone functional group indicates that it contains a carbonyl group (C=O), which is known for its reactivity in various chemical reactions, including nucleophilic additions. This compound may exhibit properties such as moderate to high stability under standard conditions, but its reactivity can vary depending on the surrounding environment and the presence of other functional groups. Its potential applications could span across medicinal chemistry, particularly in drug development, due to the structural motifs that are often associated with pharmacological activity. However, specific biological properties and safety profiles would require further investigation through empirical studies.
Formula:C13H9F2NO
InChI:InChI=1S/C13H9F2NO/c1-8-4-5-16-7-10(8)13(17)9-2-3-11(14)12(15)6-9/h2-7H,1H3
InChI key:InChIKey=PCTIVAXALICAIG-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=C(F)C=C1)C=2C(C)=CC=NC2
Synonyms:
  • Methanone, (3,4-difluorophenyl)(4-methyl-3-pyridinyl)-
  • (3,4-Difluorophenyl)(4-methyl-3-pyridinyl)methanone
Found 1 products.