CymitQuimica logo

CAS 1187163-91-2

:

(4-Methyl-2-pyridinyl)(4-phenoxyphenyl)methanone

Description:
(4-Methyl-2-pyridinyl)(4-phenoxyphenyl)methanone, identified by its CAS number 1187163-91-2, is an organic compound characterized by its complex structure, which includes a pyridine ring and a phenoxyphenyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. It may display moderate to high lipophilicity due to the presence of multiple aromatic rings, which can influence its solubility in organic solvents. The presence of the methyl group on the pyridine ring can affect its electronic properties, potentially enhancing its reactivity or interaction with biological targets. Additionally, this compound may have applications in pharmaceuticals or materials science, given the functional groups that can participate in further chemical modifications. As with many organic compounds, its behavior in different environments, such as in solution or solid-state, can vary significantly based on factors like temperature and pH. Safety and handling precautions should be observed, as with any chemical substance.
Formula:C19H15NO2
InChI:InChI=1S/C19H15NO2/c1-14-11-12-20-18(13-14)19(21)15-7-9-17(10-8-15)22-16-5-3-2-4-6-16/h2-13H,1H3
InChI key:InChIKey=DLGNNGCNTJVQFW-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(C)=CC=N1)C2=CC=C(OC3=CC=CC=C3)C=C2
Synonyms:
  • Methanone, (4-methyl-2-pyridinyl)(4-phenoxyphenyl)-
  • (4-Methyl-2-pyridinyl)(4-phenoxyphenyl)methanone
Found 1 products.