CAS 1187163-92-3
:4-(6-Methoxy-2-pyridinyl)benzonitrile
Description:
4-(6-Methoxy-2-pyridinyl)benzonitrile, identified by its CAS number 1187163-92-3, is an organic compound characterized by its structural features, which include a benzonitrile core substituted with a pyridine ring that contains a methoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological targets. Additionally, the nitrile functional group contributes to its polarity and can participate in hydrogen bonding, making it a candidate for applications in medicinal chemistry and material science. The compound's unique structure may also impart specific biological activities, making it of interest in drug discovery and development. Overall, 4-(6-Methoxy-2-pyridinyl)benzonitrile represents a versatile scaffold for further chemical modifications and investigations.
Formula:C13H10N2O
InChI:InChI=1S/C13H10N2O/c1-16-13-4-2-3-12(15-13)11-7-5-10(9-14)6-8-11/h2-8H,1H3
InChI key:InChIKey=KVOUCSMAMRBLKH-UHFFFAOYSA-N
SMILES:O(C)C1=NC(=CC=C1)C2=CC=C(C#N)C=C2
Synonyms:- Benzonitrile, 4-(6-methoxy-2-pyridinyl)-
- 4-(6-Methoxy-2-pyridinyl)benzonitrile
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
