CymitQuimica logo

CAS 1187164-05-1

:

[4-(Hexyloxy)phenyl](4-methyl-3-pyridinyl)methanone

Description:
[4-(Hexyloxy)phenyl](4-methyl-3-pyridinyl)methanone, with the CAS number 1187164-05-1, is a synthetic organic compound characterized by its complex molecular structure, which includes a phenyl group substituted with a hexyloxy chain and a pyridinyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The hexyloxy group contributes to its hydrophobic characteristics, while the pyridinyl group may impart basicity and influence its solubility in various solvents. The compound's structure suggests potential applications in pharmaceuticals or materials science, particularly in the development of organic electronic devices or as intermediates in chemical synthesis. Its specific interactions, such as binding affinity in biological systems or reactivity in chemical reactions, would depend on the context of its use and the presence of other functional groups in a given formulation. Overall, this compound represents a versatile structure with potential utility in various chemical applications.
Formula:C19H23NO2
InChI:InChI=1S/C19H23NO2/c1-3-4-5-6-13-22-17-9-7-16(8-10-17)19(21)18-14-20-12-11-15(18)2/h7-12,14H,3-6,13H2,1-2H3
InChI key:InChIKey=RRESOPFBRLCHDY-UHFFFAOYSA-N
SMILES:C(=O)(C=1C(C)=CC=NC1)C2=CC=C(OCCCCCC)C=C2
Synonyms:
  • Methanone, [4-(hexyloxy)phenyl](4-methyl-3-pyridinyl)-
  • [4-(Hexyloxy)phenyl](4-methyl-3-pyridinyl)methanone
Found 1 products.