CymitQuimica logo

CAS 1187164-13-1

:

(3-Methyl-2-pyridinyl)(4-nitrophenyl)methanone

Description:
(3-Methyl-2-pyridinyl)(4-nitrophenyl)methanone, identified by its CAS number 1187164-13-1, is an organic compound characterized by its complex structure, which includes a pyridine ring and a nitrophenyl group. This compound typically exhibits a yellow to orange color due to the presence of the nitro group, which can also influence its reactivity and solubility in various solvents. It is likely to be a solid at room temperature, with potential applications in pharmaceuticals, agrochemicals, or as a chemical intermediate due to its functional groups. The presence of the methyl group on the pyridine ring can affect its electronic properties, potentially enhancing its reactivity in electrophilic substitution reactions. Additionally, the nitro group is known for its electron-withdrawing effects, which can further modify the compound's chemical behavior. Overall, this compound's unique structural features contribute to its potential utility in various chemical applications, although specific properties such as melting point, boiling point, and solubility would need to be referenced from experimental data for precise applications.
Formula:C13H10N2O3
InChI:InChI=1S/C13H10N2O3/c1-9-3-2-8-14-12(9)13(16)10-4-6-11(7-5-10)15(17)18/h2-8H,1H3
InChI key:InChIKey=CIQKNJHBMVCRGW-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(N(=O)=O)C=C1)C2=C(C)C=CC=N2
Synonyms:
  • (3-Methyl-2-pyridinyl)(4-nitrophenyl)methanone
  • Methanone, (3-methyl-2-pyridinyl)(4-nitrophenyl)-
Found 1 products.