CymitQuimica logo

CAS 1187165-21-4

:

(2-Methyl-4-pyridinyl)[4-(pentyloxy)phenyl]methanone

Description:
The chemical substance known as (2-Methyl-4-pyridinyl)[4-(pentyloxy)phenyl]methanone, with the CAS number 1187165-21-4, is a compound that features a pyridine ring substituted with a methyl group and a phenyl group that is further substituted with a pentyloxy group. This structure suggests that the compound may exhibit properties typical of both aromatic and heterocyclic compounds, potentially influencing its reactivity and solubility. The presence of the pentyloxy group indicates that it may have moderate lipophilicity, which could affect its biological activity and interaction with lipid membranes. Additionally, the methanone functional group suggests that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. Overall, the compound's unique structural features may contribute to its potential applications in pharmaceuticals, agrochemicals, or materials science, although specific biological or chemical properties would require further investigation through empirical studies.
Formula:C18H21NO2
InChI:InChI=1S/C18H21NO2/c1-3-4-5-12-21-17-8-6-15(7-9-17)18(20)16-10-11-19-14(2)13-16/h6-11,13H,3-5,12H2,1-2H3
InChI key:InChIKey=HWQJWEHIHKGCPJ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(OCCCCC)C=C1)C=2C=C(C)N=CC2
Synonyms:
  • (2-Methyl-4-pyridinyl)[4-(pentyloxy)phenyl]methanone
  • Methanone, (2-methyl-4-pyridinyl)[4-(pentyloxy)phenyl]-
Found 1 products.