CymitQuimica logo

CAS 1187927-92-9

:

(3S)-3-(4-Fluorophenoxy)pyrrolidine

Description:
(3S)-3-(4-Fluorophenoxy)pyrrolidine is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered ring containing one nitrogen atom. The presence of a fluorophenoxy group at the 3-position of the pyrrolidine ring introduces both hydrophobic and electron-withdrawing characteristics, influencing the compound's reactivity and potential biological activity. The fluorine atom enhances the lipophilicity and may affect the compound's interaction with biological targets, making it of interest in medicinal chemistry. This compound is typically studied for its potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological or psychiatric conditions. Its stereochemistry, indicated by the (3S) designation, suggests that it has specific spatial arrangements that can significantly impact its pharmacological properties. Overall, (3S)-3-(4-Fluorophenoxy)pyrrolidine is a compound of interest due to its unique structural features and potential therapeutic applications.
Formula:C10H12FNO
InChI:InChI=1S/C10H12FNO/c11-8-1-3-9(4-2-8)13-10-5-6-12-7-10/h1-4,10,12H,5-7H2/t10-/m0/s1
InChI key:InChIKey=YKPHNAHLNXEANR-JTQLQIEISA-N
SMILES:O(C1=CC=C(F)C=C1)[C@H]2CCNC2
Synonyms:
  • Pyrrolidine, 3-(4-fluorophenoxy)-, (3S)-
  • (S)-3-(4-Fluorophenoxy)pyrrolidine
  • (3S)-3-(4-Fluorophenoxy)pyrrolidine
Found 3 products.