CymitQuimica logo

CAS 1187931-16-3

:

Acetamide, 2-amino-N-cyclopentyl-, hydrochloride (1:1)

Description:
Acetamide, 2-amino-N-cyclopentyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from acetic acid. This substance features a cyclopentyl group attached to the nitrogen atom, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the amino group indicates potential basicity, which can influence its reactivity and interaction with other chemical species. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure suggests it could participate in hydrogen bonding, affecting its physical properties such as melting point and solubility. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage in laboratory or industrial settings. Overall, the characteristics of this compound make it a subject of interest for further research and application in chemical and pharmaceutical fields.
Formula:C7H14N2O·ClH
InChI:InChI=1S/C7H14N2O.ClH/c8-5-7(10)9-6-3-1-2-4-6;/h6H,1-5,8H2,(H,9,10);1H
InChI key:InChIKey=KPLHAJPRECQCRB-UHFFFAOYSA-N
SMILES:N(C(CN)=O)C1CCCC1.Cl
Synonyms:
  • Acetamide, 2-amino-N-cyclopentyl-, hydrochloride (1:1)
Found 4 products.