CymitQuimica logo

CAS 1187932-00-8

:

Pyrazolo[1,5-a]pyridine-3-methanamine, hydrochloride (1:2)

Description:
Pyrazolo[1,5-a]pyridine-3-methanamine, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrazole and pyridine moieties. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the methanamine group contributes to its basicity and potential reactivity, making it of interest in various chemical and pharmaceutical applications. Its molecular structure allows for potential interactions with biological targets, which may be explored in medicinal chemistry. The compound's CAS number, 1187932-00-8, serves as a unique identifier for regulatory and research purposes. As with many nitrogen-containing heterocycles, it may exhibit interesting pharmacological properties, although specific biological activities would require further investigation through experimental studies. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.
Formula:C8H9N3·2ClH
InChI:InChI=1S/C8H9N3.2ClH/c9-5-7-6-10-11-4-2-1-3-8(7)11;;/h1-4,6H,5,9H2;2*1H
InChI key:InChIKey=IYDFIGRTKJXLJD-UHFFFAOYSA-N
SMILES:C(N)C1=C2N(N=C1)C=CC=C2.Cl
Synonyms:
  • Pyrazolo[1,5-a]pyridine-3-methanamine, hydrochloride (1:2)
Found 3 products.