CymitQuimica logo

CAS 1188264-16-5

:

1-Piperidinecarboxylicacid, 3-(1H-pyrazol-3-yl)-, 1,1-dimethylethyl ester

Description:
1-Piperidinecarboxylic acid, 3-(1H-pyrazol-3-yl)-, 1,1-dimethylethyl ester is a chemical compound characterized by its unique structure, which includes a piperidine ring and a pyrazole moiety. This compound features a carboxylic acid derivative, where the carboxylic acid is esterified with a tert-butyl group, enhancing its lipophilicity and potentially influencing its biological activity. The presence of the pyrazole ring suggests potential applications in medicinal chemistry, as pyrazoles are known for their diverse pharmacological properties. The compound may exhibit characteristics such as moderate to high solubility in organic solvents, and its stability can be influenced by the ester functional group. Additionally, the presence of nitrogen atoms in both the piperidine and pyrazole rings may contribute to its reactivity and interaction with biological targets. Overall, this compound's structural features suggest potential utility in drug development and other chemical applications, although specific biological activities would require further investigation.
Formula:C13H21N3O2
InChI:InChI=1S/C13H21N3O2/c1-13(2,3)18-12(17)16-8-4-5-10(9-16)11-6-7-14-15-11/h6-7,10H,4-5,8-9H2,1-3H3,(H,14,15)
InChI key:RNKABFNMJPBYKN-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCCC(C1)C2=CC=NN2
Found 5 products.