CymitQuimica logo

CAS 119004-72-7

:

methyl 2-amino-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate

Description:
Methyl 2-amino-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate, with the CAS number 119004-72-7, is a chemical compound characterized by its complex bicyclic structure that includes a benzothiophene moiety. This compound features an amino group and a carboxylate ester, which contribute to its potential reactivity and solubility properties. The presence of the phenyl group enhances its aromatic character, potentially influencing its electronic properties and interactions with biological systems. Methyl esters are generally known for their moderate polarity, which can affect their solubility in various solvents. The tetrahydro configuration indicates that the compound has a saturated ring system, which may impart stability and influence its pharmacokinetic properties. Due to its structural features, this compound may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. However, specific data regarding its toxicity, environmental impact, and detailed biological activity would require further investigation and experimental validation.
Formula:C16H17NO2S
InChI:InChI=1/C16H17NO2S/c1-19-16(18)14-12-8-7-11(9-13(12)20-15(14)17)10-5-3-2-4-6-10/h2-6,11H,7-9,17H2,1H3
InChI key:BVXJDKFMMQTUGI-UHFFFAOYSA-N
SMILES:COC(=O)c1c2CCC(Cc2sc1N)c1ccccc1
Synonyms:
  • Benzo[b]thiophene-3-carboxylic acid, 2-amino-4,5,6,7-tetrahydro-6-phenyl-, methyl ester
  • Methyl 2-amino-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate
Found 3 products.