CymitQuimica logo

CAS 1190315-61-7

:

3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine

Description:
3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both bromine and trifluoromethyl functional groups. The presence of the bromine atom introduces significant reactivity, making it a useful intermediate in various chemical syntheses. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, often increasing potency in pharmaceutical applications. This compound is typically a solid at room temperature and exhibits stability under standard conditions, although it may be sensitive to moisture and light. Its molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Additionally, the compound's unique electronic properties, derived from the trifluoromethyl group, can affect its interaction with biological targets, making it of interest in drug discovery and development. Overall, 3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine represents a valuable compound in the field of organic synthesis and medicinal chemistry.
Formula:C8H4BrF3N2
InChI:InChI=1S/C8H4BrF3N2/c9-5-3-13-6-1-7(8(10,11)12)14-2-4(5)6/h1-3,13H
InChI key:InChIKey=PFBFXIPUSOWQGJ-UHFFFAOYSA-N
SMILES:BrC=1C=2C(=CC(C(F)(F)F)=NC2)NC1
Synonyms:
  • 3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine
  • 1H-Pyrrolo[3,2-c]pyridine, 3-bromo-6-(trifluoromethyl)-
Found 3 products.