CymitQuimica logo

CAS 1190317-61-3

:

6-Methoxy-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid

Description:
6-Methoxy-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which consists of a fused pyrrole and pyridine ring system. This compound features a methoxy group (-OCH3) at the 6-position and a carboxylic acid group (-COOH) at the 3-position, contributing to its potential biological activity. The presence of these functional groups suggests that it may exhibit properties such as solubility in polar solvents and the ability to participate in hydrogen bonding, which can influence its reactivity and interactions with biological targets. The compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as derivatives of pyrrolopyridines have been explored for various pharmacological activities. Its molecular structure and functional groups may also play a role in its stability and reactivity under different conditions. As with many heterocycles, the compound's properties can be further influenced by substituents and the overall molecular environment.
Formula:C9H8N2O3
InChI:InChI=1S/C9H8N2O3/c1-14-7-3-2-5-6(9(12)13)4-10-8(5)11-7/h2-4H,1H3,(H,10,11)(H,12,13)
InChI key:InChIKey=YIFJBHAQLNGXJP-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(=NC(OC)=CC2)NC1
Synonyms:
  • 6-Methoxy-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid
  • 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, 6-methoxy-
  • 6-Methoxy-7-azaindole-3-carboxylic acid
Found 3 products.