CymitQuimica logo

CAS 1190321-94-8

:

5-Fluoro-1H-pyrrolo[2,3-b]pyridin-6-amine

Description:
5-Fluoro-1H-pyrrolo[2,3-b]pyridin-6-amine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a fluorine atom at the 5-position and an amino group at the 6-position enhances its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks have been explored for their roles in targeting various biological pathways. The compound's molecular interactions, stability, and reactivity can be influenced by the electronic effects of the fluorine substituent and the amino group, making it a subject of interest in synthetic and medicinal chemistry research. Safety and handling considerations should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C7H6FN3
InChI:InChI=1S/C7H6FN3/c8-5-3-4-1-2-10-7(4)11-6(5)9/h1-3H,(H3,9,10,11)
InChI key:InChIKey=FPTXNABRKRGXII-UHFFFAOYSA-N
SMILES:FC=1C=C2C(=NC1N)NC=C2
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridin-6-amine, 5-fluoro-
  • 5-Fluoro-1H-pyrrolo[2,3-b]pyridin-6-amine
Found 4 products.