CymitQuimica logo

CAS 1190862-68-0

:

ethyl 5,6-dibroMonicotinate

Description:
Ethyl 5,6-dibromonicotinate is a chemical compound that belongs to the class of nicotinic acid derivatives, characterized by the presence of bromine substituents at the 5 and 6 positions of the pyridine ring. This compound features an ethyl ester functional group, which contributes to its solubility and reactivity. Typically, compounds like ethyl 5,6-dibromonicotinate exhibit moderate to high polarity due to the presence of both the ester and the bromine atoms, which can influence their interactions in biological systems and chemical reactions. The bromine atoms can also enhance the compound's reactivity, making it a potential candidate for various synthetic applications, including medicinal chemistry and agrochemicals. Additionally, the presence of the nicotinic structure may impart biological activity, potentially influencing receptor interactions or enzyme inhibition. Safety and handling precautions should be observed due to the potential toxicity associated with brominated compounds. Overall, ethyl 5,6-dibromonicotinate is a versatile compound with applications in research and development within the fields of chemistry and pharmacology.
Formula:C8H7Br2NO2
InChI:InChI=1S/C8H7Br2NO2/c1-2-13-8(12)5-3-6(9)7(10)11-4-5/h3-4H,2H2,1H3
InChI key:JBZFHUQLVRJVMC-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CC(=C(N=C1)Br)Br
Found 3 products.