CymitQuimica logo

CAS 1191062-03-9

:

C-(1,1-Dimethylethyl) N-[2-(4-boronophenyl)ethyl]-N-methylcarbamate

Description:
C-(1,1-Dimethylethyl) N-[2-(4-boronophenyl)ethyl]-N-methylcarbamate, identified by its CAS number 1191062-03-9, is a chemical compound that features a carbamate functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N) that is also connected to an alkyl or aryl group. This specific compound includes a tert-butyl group (1,1-dimethylethyl) and a boron-containing phenyl group, which suggests potential applications in medicinal chemistry or materials science, particularly in the development of boron-based compounds for drug delivery or as therapeutic agents. The presence of the boron atom may enhance the compound's reactivity or facilitate interactions with biological targets. Additionally, the methyl group attached to the nitrogen indicates that it may exhibit specific steric and electronic properties, influencing its solubility and biological activity. Overall, this compound's unique structure suggests it could be of interest in various chemical and pharmaceutical research contexts.
Formula:C14H22BNO4
InChI:InChI=1S/C14H22BNO4/c1-14(2,3)20-13(17)16(4)10-9-11-5-7-12(8-6-11)15(18)19/h5-8,18-19H,9-10H2,1-4H3
InChI key:InChIKey=SHIGSPOXCDMZRV-UHFFFAOYSA-N
SMILES:C(CN(C(OC(C)(C)C)=O)C)C1=CC=C(B(O)O)C=C1
Synonyms:
  • C-(1,1-Dimethylethyl) N-[2-(4-boronophenyl)ethyl]-N-methylcarbamate
  • [4-(2-[[(tert-Butoxy)carbonyl](methyl)amino]ethyl)phenyl]boronic acid
  • Carbamic acid, N-[2-(4-boronophenyl)ethyl]-N-methyl-, C-(1,1-dimethylethyl) ester
Found 3 products.