CymitQuimica logo

CAS 1191063-31-6

:

1,1-Dimethylethyl N-methyl-N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate

Description:
1,1-Dimethylethyl N-methyl-N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate, identified by its CAS number 1191063-31-6, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a boron-containing moiety. This compound features a tert-butyl group, contributing to its steric bulk, and a dioxaborolane ring, which is known for its reactivity and ability to form stable complexes with various nucleophiles. The presence of the N-methyl and ethyl substituents enhances its solubility and potential biological activity. Typically, compounds of this nature may exhibit properties such as moderate to high lipophilicity, which can influence their bioavailability and interaction with biological systems. Additionally, the presence of the boron atom may impart unique chemical reactivity, making it of interest in synthetic chemistry and potential applications in medicinal chemistry. As with any chemical substance, safety data and handling precautions should be reviewed before use.
Formula:C20H32BNO4
InChI:InChI=1S/C20H32BNO4/c1-18(2,3)24-17(23)22(8)14-13-15-9-11-16(12-10-15)21-25-19(4,5)20(6,7)26-21/h9-12H,13-14H2,1-8H3
InChI key:InChIKey=PARGGKARAWEVQO-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC=C(CCN(C(OC(C)(C)C)=O)C)C=C2
Synonyms:
  • Carbamic acid, N-methyl-N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl N-methyl-N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate
Found 4 products.