CymitQuimica logo

CAS 119290-61-8

:

H-DL-Phe-OBzl . p-tosylate

Description:
H-DL-Phe-OBzl·p-tosylate, with the CAS number 119290-61-8, is a chemical compound that serves as a derivative of phenylalanine, an essential amino acid. This compound features a benzyl ester (OBzl) of the amino acid, which enhances its lipophilicity and stability. The presence of the p-toluenesulfonate (p-tosylate) group indicates that it is a sulfonate ester, which can improve solubility in organic solvents and facilitate reactions such as nucleophilic substitutions. H-DL-Phe-OBzl·p-tosylate is often utilized in peptide synthesis and medicinal chemistry due to its ability to act as a protecting group for the amino functionality, allowing for selective reactions at other sites on the molecule. Its characteristics include a relatively high molecular weight and specific stereochemical properties, as it is a racemic mixture of the D and L forms of phenylalanine. The compound is typically handled under standard laboratory conditions, and its stability makes it suitable for various synthetic applications in organic chemistry.
Formula:C16H17NO2·C7H8O3S
InChI:InChI=1S/C16H17NO2.C7H8O3S/c17-15(11-13-7-3-1-4-8-13)16(18)19-12-14-9-5-2-6-10-14;1-6-2-4-7(5-3-6)11(8,9)10/h1-10,15H,11-12,17H2;2-5H,1H3,(H,8,9,10)
InChI key:ZLZGBBIPWXUQST-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C(C=C1)CC(C(=O)OCC2=CC=CC=C2)N
Found 3 products.