CymitQuimica logo

CAS 1193-59-5

:

1,5-dimethyl-1H-pyrrole-2-carbaldehyde

Description:
1,5-Dimethyl-1H-pyrrole-2-carbaldehyde is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features two methyl groups at the 1 and 5 positions of the pyrrole ring, contributing to its unique chemical properties. The presence of a formyl group (-CHO) at the 2-position makes it an aldehyde, which is significant for its reactivity, particularly in condensation reactions and as a potential electrophile in various organic syntheses. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and conditions. It is soluble in organic solvents, which facilitates its use in synthetic organic chemistry. Due to its structural features, 1,5-dimethyl-1H-pyrrole-2-carbaldehyde may exhibit biological activity, making it of interest in medicinal chemistry and the development of pharmaceuticals. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H9NO
InChI:InChI=1/C7H9NO/c1-6-3-4-7(5-9)8(6)2/h3-5H,1-2H3
InChI key:VARKINVTPLTZMI-UHFFFAOYSA-N
SMILES:Cc1ccc(C=O)n1C
Synonyms:
  • 1H-pyrrole-2-carboxaldehyde, 1,5-dimethyl-
Found 3 products.