CAS 119329-48-5
:3-amino-1-methyl-pyrrolidin-2-one
Description:
3-Amino-1-methyl-pyrrolidin-2-one, with the CAS number 119329-48-5, is a heterocyclic organic compound featuring a pyrrolidine ring. This compound is characterized by the presence of an amino group and a methyl group attached to the pyrrolidine structure, which contributes to its basicity and potential reactivity. It typically appears as a colorless to light yellow liquid or solid, depending on its purity and form. The molecular structure allows for hydrogen bonding, which can influence its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and the presence of other functional groups. As with many nitrogen-containing heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C5H10N2O
InChI:InChI=1/C5H10N2O/c1-7-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3
SMILES:CN1CCC(C1=O)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Pyrrolidinone, 3-amino-1-methyl-
CAS:Formula:C5H10N2OPurity:95%Color and Shape:LiquidMolecular weight:114.14573-Amino-1-methylpyrrolidin-2-one
CAS:3-Amino-1-methylpyrrolidin-2-oneFormula:C5H10N2OPurity:95%Color and Shape: colourless gel or oilMolecular weight:114.15g/mol3-Amino-1-methylpyrrolidin-2-one
CAS:3-Amino-1-methylpyrrolidin-2-one is a versatile building block that has many applications in the research field. It can be used as a reagent or a speciality chemical and as an intermediate in organic synthesis. 3-Amino-1-methylpyrrolidin-2-one is also used as a reaction component and scaffold for complex compounds. This chemical has CAS number 119329-48-5.Formula:C5H10N2OPurity:Min. 98 Area-%Color and Shape:Clear LiquidMolecular weight:114.15 g/mol3-Amino-N-methyl-2-pyrrolidinone
CAS:Formula:C5H10N2OPurity:98%Color and Shape:SolidMolecular weight:114.148



