CymitQuimica logo

CAS 119329-48-5

:

3-amino-1-methyl-pyrrolidin-2-one

Description:
3-Amino-1-methyl-pyrrolidin-2-one, with the CAS number 119329-48-5, is a heterocyclic organic compound featuring a pyrrolidine ring. This compound is characterized by the presence of an amino group and a methyl group attached to the pyrrolidine structure, which contributes to its basicity and potential reactivity. It typically appears as a colorless to light yellow liquid or solid, depending on its purity and form. The molecular structure allows for hydrogen bonding, which can influence its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and the presence of other functional groups. As with many nitrogen-containing heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C5H10N2O
InChI:InChI=1/C5H10N2O/c1-7-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3
InChI key:VZDMTWJWRRUJED-UHFFFAOYSA-N
SMILES:CN1CCC(C1=O)N
Found 5 products.