CymitQuimica logo

CAS 1194044-26-2

:

[S(R)]-N-[1-(5-Bromo-2-fluorophenyl)ethylidene]-2-methyl-2-propanesulfinamide

Description:
The chemical substance "[S(R)]-N-[1-(5-Bromo-2-fluorophenyl)ethylidene]-2-methyl-2-propanesulfinamide," with the CAS number 1194044-26-2, is a sulfinamide compound characterized by the presence of a sulfinyl group (R-S(=O)-R') attached to a nitrogen atom. This compound features a chiral center, indicated by the [S(R)] designation, which suggests that it exhibits stereoisomerism. The structure includes a substituted phenyl group with bromine and fluorine atoms, contributing to its potential biological activity and reactivity. The ethylidene moiety enhances the compound's structural complexity, while the presence of a sulfinamide functional group may impart unique properties, such as solubility and reactivity in various chemical environments. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological applications. The specific characteristics, including melting point, solubility, and reactivity, would depend on the compound's detailed molecular structure and interactions with other substances.
Formula:C12H15BrFNOS
InChI:InChI=1S/C12H15BrFNOS/c1-8(15-17(16)12(2,3)4)10-7-9(13)5-6-11(10)14/h5-7H,1-4H3/t17-/m1/s1
InChI key:InChIKey=WOADMISSFZLHGL-QGZVFWFLSA-N
SMILES:C(=NS([C@](C)(C)C)=O)(C)C1=C(F)C=CC(Br)=C1
Synonyms:
  • [S(R)]-N-[1-(5-Bromo-2-fluorophenyl)ethylidene]-2-methyl-2-propanesulfinamide
  • 2-Propanesulfinamide, N-[1-(5-bromo-2-fluorophenyl)ethylidene]-2-methyl-, [S(R)]-
Found 1 products.