CAS 119413-54-6: Topotecan hydrochloride
Description:Topotecan hydrochloride is a chemotherapeutic agent primarily used in the treatment of certain types of cancer, including ovarian cancer and small cell lung cancer. It is a topoisomerase I inhibitor, which means it interferes with the enzyme responsible for DNA replication, ultimately leading to cell death. The substance appears as a white to off-white crystalline powder and is soluble in water, making it suitable for intravenous administration. Its molecular formula includes a specific arrangement of carbon, hydrogen, nitrogen, and oxygen atoms, contributing to its pharmacological properties. Topotecan hydrochloride is typically administered in a clinical setting under strict medical supervision due to potential side effects, which can include nausea, vomiting, and myelosuppression. The drug's mechanism of action involves the stabilization of the topoisomerase I-DNA complex, preventing the re-ligation of DNA strands and thereby disrupting the cell cycle. As with many chemotherapeutic agents, its use is carefully monitored to balance efficacy with the risk of adverse effects.
Formula:C23H23N3O5·ClH
InChI:InChI=1S/C23H23N3O5.ClH/c1-4-23(30)16-8-18-20-12(9-26(18)21(28)15(16)11-31-22(23)29)7-13-14(10-25(2)3)19(27)6-5-17(13)24-20;/h5-8,27,30H,4,9-11H2,1-3H3;1H/t23-;/m0./s1
InChI key:InChIKey=DGHHQBMTXTWTJV-BQAIUKQQSA-N
SMILES:Cl.O=C1OCC=2C(=O)N3C(=CC2C1(O)CC)C=4N=C5C=CC(O)=C(C5=CC4C3)CN(C)C
- Synonyms:
- SKF 104864A
- Topotecan HCl
- (S)-10-[(Dimethylamino)methyl]-4-ethyl-4,9-dihydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione monohydrochloride
- Hycamtin
- (S)-10-((Dimethylamino)Methyl)-4-Ethyl-4,9-Dihydroxy-1H-Pyrano[3',4':6,7]Indolizino[1,2-B]Quinoline-3,14(4H,12H)-Dione Hydrochloride
- Nogitecan hydrochloride
- (4S)-10-[(dimethylamino)methyl]-4-ethyl-4,9-dihydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione
- NSC 609669
- 1H-Pyrano[3′,4′:6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione, 10-[(dimethylamino)methyl]-4-ethyl-4,9-dihydroxy-, monohydrochloride, (S)-
- 1H-Pyrano[3′,4′:6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione, 10-[(dimethylamino)methyl]-4-ethyl-4,9-dihydroxy-, hydrochloride (1:1), (4S)-
- See more synonyms
- (4S)-10-[(dimethylamino)methyl]-4-ethyl-4,9-dihydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione hydrochloride (1:1)
- 1H-Pyrano[3′,4′:6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione, 10-[(dimethylamino)methyl]-4-ethyl-4,9-dihydroxy-, monohydrochloride, (4S)-