CAS 119425-90-0
:LOUREIRIN B
Description:
Loureirin B is a natural compound classified as a flavonoid, specifically a type of flavanone, which is derived from the Brazilian plant species known as "Loureiro" (Licaria puechiana). It is characterized by its unique chemical structure, which includes multiple hydroxyl groups and a flavonoid backbone, contributing to its potential biological activities. Loureirin B has garnered interest in pharmacological research due to its reported antioxidant, anti-inflammatory, and antimicrobial properties. Studies suggest that it may exhibit protective effects against oxidative stress and could have implications in the treatment of various diseases. Additionally, its potential role in modulating cellular signaling pathways is being explored. As with many natural compounds, the bioavailability and efficacy of Loureirin B in therapeutic applications are subjects of ongoing research. Its CAS number, 119425-90-0, serves as a unique identifier for this compound in chemical databases, facilitating its study and application in various scientific fields.
Formula:C18H20O5
InChI:InChI=1/C18H20O5/c1-21-14-10-17(22-2)15(18(11-14)23-3)8-9-16(20)12-4-6-13(19)7-5-12/h4-7,10-11,19H,8-9H2,1-3H3
InChI key:InChIKey=ZPFRAPVRYLGYEC-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC=C(O)C=C1)C2=C(OC)C=C(OC)C=C2OC
Synonyms:- 1-(4-Hydroxyphenyl)-3-(2,4,6-trimethoxyphenyl)-1-propanone
- 1-(4-Hydroxyphenyl)-3-(2,4,6-trimethoxyphenyl)propan-1-one
- 1-Propanone, 1-(4-hydroxyphenyl)-3-(2,4,6-trimethoxyphenyl)-
- 4′-Hydroxy-2,4,6-trimethoxydihydrochalcone
- Lr-B
- Propan-1-one, 1-(4-hydroxyphenyl)-3-(2,4,6-trimethoxyphenyl)-
- Loureirin B
- Loureirin B
- cochinchinenin B
- LOUREIRIN B USP/EP/BP
- Loureirin B, 98%, from Dracaena cochinchinensis (Lour.) S. C. Chen
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
1-Propanone, 1-(4-hydroxyphenyl)-3-(2,4,6-trimethoxyphenyl)-
CAS:Formula:C18H20O5Purity:97%Color and Shape:SolidMolecular weight:316.3484Loureirin B
CAS:1-(4-Hydroxyphenyl)-3-(2,4,6-trimethoxyphenyl)propan-1-oneFormula:C18H20O5Purity:99%Molecular weight:316.351-(4-Hydroxyphenyl)-3-(2,4,6-Trimethoxyphenyl)Propan-1-One
CAS:1-(4-Hydroxyphenyl)-3-(2,4,6-Trimethoxyphenyl)Propan-1-OneFormula:C18H20O5Purity:99%Molecular weight:316.35Loureirin B
CAS:Loureirin B, a flavonoid extracted from Dracaena cochinchinensis, is an inhibitor of plasminogen activator inhibitor-1 (PAI-1), with an IC50 of 26.10 μM; Loureirin B also inhibits KATP, the phosphorylation of ERK and JNK, and has anti-diabetic activity.Loureirin B inhibits fibroblast proliferation and extracellular matrix deposition in hypertrophic scar via TGF-β/Smad pathway, loureirin B can suppress tetrodotoxin-sensitive (TTX-S) voltage-gated sodium currents in a dose-dependent way.Formula:C18H20O5Purity:95%~99%Molecular weight:316.353Loureirin B
CAS:Loureirin B suppresses fibrosis by modulating MMPs/TIMPs, hindering fibroblast growth, and targeting TGF-β1/Smad2/3 pathway.Formula:C18H20O5Purity:99.33% - 99.86%Color and Shape:SolidMolecular weight:316.35Loureirin B
CAS:Loureirin B is a natural polyphenolic compound, which is derived from the resin of Dracaena cochinchinensis, commonly known as Dragon's Blood. This compound exhibits its mode of action primarily through the inhibition of key inflammatory pathways, including the suppression of cyclooxygenase-2 (COX-2) and the reduction of pro-inflammatory cytokines. Such mechanisms suggest its potential in modulating inflammatory responses effectively.Formula:C18H20O5Purity:Min. 95%Color and Shape:White PowderMolecular weight:316.35 g/mol








