CAS 119425-91-1

3-(2,4-Dihydroxy-6-methoxyphenyl)-1-(4-hydroxyphenyl)-1-propanone

Description:

3-(2,4-Dihydroxy-6-methoxyphenyl)-1-(4-hydroxyphenyl)-1-propanone, identified by its CAS number 119425-91-1, is an organic compound characterized by its complex structure featuring multiple hydroxyl and methoxy functional groups. This compound belongs to the class of flavonoids and is known for its potential antioxidant properties, which may contribute to various biological activities. The presence of hydroxyl groups enhances its ability to donate hydrogen atoms, making it a good candidate for scavenging free radicals. Additionally, the methoxy group can influence its solubility and reactivity. The compound's structure suggests it may exhibit significant interactions with biological systems, potentially impacting cellular processes. Its applications could span across pharmaceuticals, nutraceuticals, and cosmetic formulations, where antioxidant and anti-inflammatory properties are desirable. However, specific studies are necessary to fully elucidate its biological effects and potential therapeutic uses. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other substances.

Formula: C₁₆H₁₆O₅

InChI: InChI=1S/C16H16O5/c1-21-16-9-12(18)8-15(20)13(16)6-7-14(19)10-2-4-11(17)5-3-10/h2-5,8-9,17-18,20H,6-7H2,1H3

InChI key: InChIKey=AQMBVNGTZRFEPF-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=CC=C(O)C=C1)C2=C(OC)C=C(O)C=C2O

Synonyms:

• 3-(2,4-Dihydroxy-6-methoxyphenyl)-1-(4-hydroxyphenyl)-1-propanone
• Loureirin D
• 1-Propanone, 3-(2,4-dihydroxy-6-methoxyphenyl)-1-(4-hydroxyphenyl)-

Loureirin D

CAS: 119425-91-1

Formula: C₁₆H₁₆O₅

Molecular weight: 288.30

Ref: 7W-GY2889

3-(2,4-Dihydroxy-6-methoxyphenyl)-1-(4-hydroxyphenyl)propan-1-one

CAS: 119425-91-1

3-(2,4-Dihydroxy-6-methoxyphenyl)-1-(4-hydroxyphenyl)propan-1-one

Purity: 99%

Molecular weight: 288.3g/mol

Ref: 54-OR1066734

Loureirin D

CAS: 119425-91-1

Loureirin D is a chalcone from the herbs of Dracaena cochinchinensis.

Formula: C₁₆H₁₆O₅

Purity: 99.60%

Color and Shape: Solid

Molecular weight: 288.3

Ref: TM-TN2345

Loureirin D

CAS: 119425-91-1

Formula: C₁₆H₁₆O₅

Purity: 95%~99%

Molecular weight: 288.299

Ref: BP-BP2163

Loureirin D

CAS: 119425-91-1

Loureirin D is a naturally occurring flavonoid compound, which is a bioactive constituent extracted from the traditional Chinese medicinal plant Dragon's Blood (Daemonorops draco). This compound is known for its anti-inflammatory and anticoagulant properties. Loureirin D acts primarily by modulating key signaling pathways involved in cellular inflammation and coagulation, such as the inhibition of platelet aggregation and the reduction of pro-inflammatory cytokine production.

Formula: C₁₆H₁₆O₅

Purity: Min. 95%

Molecular weight: 288.29 g/mol

Ref: 3D-UEA42591