CymitQuimica logo

CAS 119425-91-1

:

3-(2,4-Dihydroxy-6-methoxyphenyl)-1-(4-hydroxyphenyl)-1-propanone

Description:
3-(2,4-Dihydroxy-6-methoxyphenyl)-1-(4-hydroxyphenyl)-1-propanone, identified by its CAS number 119425-91-1, is an organic compound characterized by its complex structure featuring multiple hydroxyl and methoxy functional groups. This compound belongs to the class of flavonoids and is known for its potential antioxidant properties, which may contribute to various biological activities. The presence of hydroxyl groups enhances its ability to donate hydrogen atoms, making it a good candidate for scavenging free radicals. Additionally, the methoxy group can influence its solubility and reactivity. The compound's structure suggests it may exhibit significant interactions with biological systems, potentially impacting cellular processes. Its applications could span across pharmaceuticals, nutraceuticals, and cosmetic formulations, where antioxidant and anti-inflammatory properties are desirable. However, specific studies are necessary to fully elucidate its biological effects and potential therapeutic uses. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other substances.
Formula:C16H16O5
InChI:InChI=1S/C16H16O5/c1-21-16-9-12(18)8-15(20)13(16)6-7-14(19)10-2-4-11(17)5-3-10/h2-5,8-9,17-18,20H,6-7H2,1H3
InChI key:InChIKey=AQMBVNGTZRFEPF-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC=C(O)C=C1)C2=C(OC)C=C(O)C=C2O
Synonyms:
  • 3-(2,4-Dihydroxy-6-methoxyphenyl)-1-(4-hydroxyphenyl)-1-propanone
  • Loureirin D
  • 1-Propanone, 3-(2,4-dihydroxy-6-methoxyphenyl)-1-(4-hydroxyphenyl)-
Found 7 products.