CymitQuimica logo

CAS 119451-78-4

:

(~2~H_12_)-1,4-Diazabicyclo[2.2.2]octane

Description:
The chemical substance known as (2H12)-1,4-Diazabicyclo[2.2.2]octane, with the CAS number 119451-78-4, is a bicyclic compound featuring a diazabicyclo structure. This compound consists of a bicyclic framework that includes two nitrogen atoms in its structure, contributing to its basicity and potential as a ligand in coordination chemistry. It is characterized by its ability to act as a strong nucleophile and a versatile building block in organic synthesis. The presence of the nitrogen atoms allows for the formation of stable complexes with various metal ions, making it useful in catalysis and materials science. Additionally, this compound may exhibit unique solubility properties and reactivity patterns due to its bicyclic nature. Its applications can extend to pharmaceuticals, where it may serve as a scaffold for drug development. Overall, (2H12)-1,4-Diazabicyclo[2.2.2]octane is notable for its structural features and potential utility in various chemical contexts.
Formula:C6D12N2
InChI:InChI=1/C6H12N2/c1-2-8-5-3-7(1)4-6-8/h1-6H2/i1D2,2D2,3D2,4D2,5D2,6D2
InChI key:IMNIMPAHZVJRPE-LBTWDOQPSA-N
SMILES:C1(C(N2C(C(N1C(C2([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H]
Synonyms:
  • (2H12)-1,4-Diazabicyclo[2.2.2]octane
  • 1,4-Diazabicyclo[2.2.2]octane-d12
  • 1,4-Diazabicylo[2.2.2]octane-d12
  • 119451-78-4
  • T66 A B CN FNTJ & & Deutero-D12
Found 3 products.