CymitQuimica logo

CAS 1196-70-9

:

6-Formylindole

Description:
6-Formylindole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a formyl group (-CHO) at the 6-position of the indole ring distinguishes it from other indole derivatives. This compound typically appears as a yellow to brown solid and is known for its reactivity due to the aldehyde functional group, which can participate in various chemical reactions, including condensation and nucleophilic addition. 6-Formylindole is of interest in organic synthesis and medicinal chemistry, as it can serve as a building block for more complex molecules. Its properties include moderate solubility in organic solvents and potential biological activity, making it a subject of research in the development of pharmaceuticals. Additionally, it may exhibit fluorescence, which can be useful in analytical applications. As with many indole derivatives, 6-formylindole may also show interesting interactions with biological systems, warranting further investigation into its potential applications in drug discovery and development.
Formula:C9H7NO
InChI:InChI=1/C9H7NO/c11-6-7-1-2-8-3-4-10-9(8)5-7/h1-6,10H
InChI key:VSPBWOAEHQDXRD-UHFFFAOYSA-N
SMILES:c1cc2cc[nH]c2cc1C=O
Synonyms:
  • Indole-6-Carboxaldehyde
  • Indole-6-aldehyde
Found 7 products.