CymitQuimica logo

CAS 1196153-84-0

:

Ethanone, 1-(2-chloro-5-hydroxy-4-pyridinyl)-

Description:
Ethanone, 1-(2-chloro-5-hydroxy-4-pyridinyl)-, also known by its CAS number 1196153-84-0, is a chemical compound characterized by its pyridine ring structure, which includes a chlorine atom and a hydroxyl group at specific positions. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, including potential solubility in polar solvents due to the presence of the hydroxyl group. The chlorine substituent can influence its reactivity, making it a candidate for various chemical reactions, such as nucleophilic substitutions. The presence of the pyridine moiety suggests potential biological activity, as many pyridine derivatives are known for their pharmacological properties. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, this compound's unique structure and substituents contribute to its potential applications in medicinal chemistry and other fields.
Formula:C7H6ClNO2
InChI:InChI=1S/C7H6ClNO2/c1-4(10)5-2-7(8)9-3-6(5)11/h2-3,11H,1H3
InChI key:InChIKey=KOKAZIDUFAUFQC-UHFFFAOYSA-N
SMILES:C(C)(=O)C=1C(O)=CN=C(Cl)C1
Synonyms:
  • 1-(2-Chloro-5-hydroxypyridin-4-yl)ethanone
  • 1-(2-Chloro-5-hydroxypyridin-4-yl)ethan-1-one
  • Ethanone, 1-(2-chloro-5-hydroxy-4-pyridinyl)-
Found 3 products.