CymitQuimica logo

CAS 1196154-25-2

:

1,1-Dimethylethyl 3-bromo-6,7-dihydropyrazolo[1,5-a]pyrazine-5(4H)-carboxylate

Description:
1,1-Dimethylethyl 3-bromo-6,7-dihydropyrazolo[1,5-a]pyrazine-5(4H)-carboxylate, identified by its CAS number 1196154-25-2, is a chemical compound that features a complex structure characterized by a pyrazolo[1,5-a]pyrazine core. This compound contains a carboxylate functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom introduces halogenation, which can influence the compound's reactivity and interactions with other molecules. The dimethyl group attached to the carbon atom enhances steric hindrance, potentially affecting the compound's physical properties, such as solubility and boiling point. Additionally, the dihydropyrazine moiety suggests that the compound may exhibit interesting electronic properties, making it a candidate for various chemical reactions. Overall, this compound's unique structural features may provide avenues for research in medicinal chemistry, agrochemicals, or materials science, although specific applications would depend on further investigation into its biological activity and chemical behavior.
Formula:C11H16BrN3O2
InChI:InChI=1S/C11H16BrN3O2/c1-11(2,3)17-10(16)14-4-5-15-9(7-14)8(12)6-13-15/h6H,4-5,7H2,1-3H3
InChI key:InChIKey=AHUXCBVCMJGTTD-UHFFFAOYSA-N
SMILES:BrC1=C2N(CCN(C(OC(C)(C)C)=O)C2)N=C1
Synonyms:
  • tert-Butyl 3-bromo-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate
  • tert-Butyl 3-bromo-6,7-dihydropyrazolo[1,5-a]pyrazine-5(4H)-carboxylate
  • 1,1-Dimethylethyl 3-bromo-6,7-dihydropyrazolo[1,5-a]pyrazine-5(4H)-carboxylate
  • Pyrazolo[1,5-a]pyrazine-5(4H)-carboxylic acid, 3-bromo-6,7-dihydro-, 1,1-dimethylethyl ester
Found 5 products.