CymitQuimica logo

CAS 1197231-34-7

:

1-(Aminocarbonyl)-3-azetidinecarboxylic acid

Description:
1-(Aminocarbonyl)-3-azetidinecarboxylic acid, identified by its CAS number 1197231-34-7, is a chemical compound characterized by its unique structural features, including an azetidine ring, which is a four-membered cyclic amine. This compound contains both an amino group and a carboxylic acid functional group, contributing to its potential as a versatile building block in organic synthesis and medicinal chemistry. The presence of the aminocarbonyl group indicates that it can participate in various chemical reactions, such as amide formation and nucleophilic substitutions. Its azetidine structure may impart specific steric and electronic properties, influencing its reactivity and interactions with biological targets. Additionally, compounds with similar structures are often investigated for their pharmacological activities, making this substance of interest in drug development. Overall, 1-(Aminocarbonyl)-3-azetidinecarboxylic acid exemplifies the complexity and utility of small organic molecules in chemical research and applications.
Formula:C5H8N2O3
InChI:InChI=1S/C5H8N2O3/c6-5(10)7-1-3(2-7)4(8)9/h3H,1-2H2,(H2,6,10)(H,8,9)
InChI key:InChIKey=SOBSBLWGISBCGU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CN(C(N)=O)C1
Synonyms:
  • 3-Azetidinecarboxylic acid, 1-(aminocarbonyl)-
  • 1-(Aminocarbonyl)-3-azetidinecarboxylic acid
Found 1 products.