CymitQuimica logo

CAS 1197294-66-8

:

tert-Butyl 4-(4-bromothiazol-2-yl)piperazine-1-carboxylate

Description:
Tert-Butyl 4-(4-bromothiazol-2-yl)piperazine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a piperazine ring, a thiazole moiety, and a tert-butyl ester functional group. The presence of the bromine atom on the thiazole ring contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The piperazine ring is known for its role in drug design, often enhancing the pharmacological properties of compounds. Additionally, the tert-butyl group can influence the lipophilicity and stability of the molecule. As with many halogenated compounds, it may also exhibit unique interactions with biological systems, making it of interest for further research in drug discovery and development. Safety and handling precautions should be observed due to the presence of bromine and the potential for biological activity.
Formula:C12H18BrN3O2S
InChI:InChI=1S/C12H18BrN3O2S/c1-12(2,3)18-11(17)16-6-4-15(5-7-16)10-14-9(13)8-19-10/h8H,4-7H2,1-3H3
InChI key:PJTYRYGVZASDJM-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCN(CC1)C2=NC(=CS2)Br
Found 4 products.