CAS 1198-30-7
:1-Isoquinolinecarbonitrile
Description:
1-Isoquinolinecarbonitrile, with the CAS number 1198-30-7, is an organic compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound. It features a carbonitrile functional group (-C≡N) attached to the isoquinoline ring system. This compound is typically a colorless to pale yellow solid and is known for its aromatic properties, contributing to its stability and reactivity. It is soluble in organic solvents, such as ethanol and acetone, but has limited solubility in water due to its hydrophobic nature. 1-Isoquinolinecarbonitrile is of interest in various fields, including medicinal chemistry and materials science, as it can serve as a building block for the synthesis of more complex molecules. Its derivatives may exhibit biological activity, making it a subject of research in drug development. Additionally, the presence of the carbonitrile group can facilitate further chemical modifications, enhancing its utility in synthetic applications. Overall, 1-Isoquinolinecarbonitrile is a versatile compound with significant potential in both academic and industrial research.
Formula:C10H6N2
InChI:InChI=1S/C10H6N2/c11-7-10-9-4-2-1-3-8(9)5-6-12-10/h1-6H
InChI key:InChIKey=HJHXYSBRTVFEDD-UHFFFAOYSA-N
SMILES:C(#N)C=1C2=C(C=CN1)C=CC=C2
Synonyms:- 1-Cyanoisoquinoline
- Isoquinaldonitrile
- Isoquinoline-1-carbonitrile
- NSC 203335
- 1-Isoquinolinecarbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Isoquinoline-1-carbonitrile, 99%
CAS:Isoquinoline-1-carbonitrile is used as starting reagent in the syntheses of imidazo[5,1-a]isoquinolines. It is also used as intermediate in organic syntheses. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label informatFormula:C10H6N2Purity:99%Color and Shape:White to cream or pale yellow, Crystals or powder or crystalline powder or flakesMolecular weight:154.171-Cyanoisoquinoline
CAS:1-CyanoisoquinolineFormula:C10H6N2Purity:98%Color and Shape:SolidMolecular weight:154.16803Isoquinoline-1-carbonitrile
CAS:Formula:C10H6N2Purity:95%Color and Shape:SolidMolecular weight:154.16801-Isoquinolinecarbonitrile
CAS:1-Isoquinolinecarbonitrile is an isoquinoline derivative containing a nitrile group, widely used in biochemical experiments and drug synthesis research.Formula:C10H6N2Purity:99.94%Color and Shape:SolidMolecular weight:154.17




