CymitQuimica logo

CAS 119824-65-6

:

N6-Phenoxyacetyladenosine

Description:
N6-Phenoxyacetyladenosine is a modified nucleoside derivative of adenosine, characterized by the presence of a phenoxyacetyl group at the N6 position of the adenine moiety. This compound exhibits properties typical of nucleosides, including the ability to participate in biochemical reactions involving nucleotides and nucleic acids. It is known for its potential biological activities, which may include modulation of adenosine receptors, influencing cellular signaling pathways, and exhibiting anti-inflammatory or neuroprotective effects. The phenoxyacetyl modification can enhance the lipophilicity and stability of the molecule, potentially improving its pharmacokinetic properties. N6-Phenoxyacetyladenosine is often studied in the context of medicinal chemistry and pharmacology, particularly for its implications in therapeutic applications related to cardiovascular, neurological, and inflammatory diseases. As with many nucleoside analogs, its synthesis and characterization involve various organic chemistry techniques, and it is typically analyzed using methods such as NMR spectroscopy and mass spectrometry to confirm its structure and purity.
Formula:C18H19N5O6
InChI:InChI=1S/C18H19N5O6/c24-6-11-14(26)15(27)18(29-11)23-9-21-13-16(19-8-20-17(13)23)22-12(25)7-28-10-4-2-1-3-5-10/h1-5,8-9,11,14-15,18,24,26-27H,6-7H2,(H,19,20,22,25)/t11-,14-,15-,18-/m1/s1
InChI key:FLHMVFSWPWAGQW-XKLVTHTNSA-N
SMILES:C1=CC=C(C=C1)OCC(=O)NC2=C3C(=NC=N2)N(C=N3)[C@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O
Synonyms:
  • N-(Phenoxyacetyl)adenosine
  • N6-Phenoxyacetyladenosine
  • Adenosine, N-(2-phenoxyacetyl)-
  • N-(9-((2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-9H-purin-6-yl)-2-phenoxyacetamide
Found 4 products.