CAS 120-13-8
:4-Ethoxy-3-methoxybenzeneacetic acid
Description:
4-Ethoxy-3-methoxybenzeneacetic acid, also known as ethyl 3-methoxy-4-(2-carboxyethyl)phenyl ether, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both ethoxy and methoxy groups, as well as a carboxylic acid functional group. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while its solubility in water may be limited due to the presence of hydrophobic aromatic groups. The presence of the carboxylic acid group contributes to its acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Its derivatives may exhibit biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of new therapeutic agents. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C11H14O4
InChI:InChI=1S/C11H14O4/c1-3-15-9-5-4-8(7-11(12)13)6-10(9)14-2/h4-6H,3,7H2,1-2H3,(H,12,13)
InChI key:InChIKey=XVNXRPVJRCYHEW-UHFFFAOYSA-N
SMILES:O(C)C1=C(OCC)C=CC(CC(O)=O)=C1
Synonyms:- (4-Ethoxy-3-methoxyphenyl)acetic acid
- 2-(4-Ethoxy-3-methoxyphenyl)acetic acid
- 4-Ethoxy-3-methoxybenzeneacetic acid
- Acetic acid, (4-ethoxy-3-methoxyphenyl)-
- Benzeneacetic acid, 4-ethoxy-3-methoxy-
- NSC 62696
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzeneacetic acid, 4-ethoxy-3-methoxy-
CAS:Formula:C11H14O4Purity:97%Color and Shape:SolidMolecular weight:210.22654-Ethoxy-3-methoxyphenylacetic acid
CAS:4-Ethoxy-3-methoxyphenylacetic acid
Molecular weight:210.22646g/mol4-Ethoxy-3-methoxyphenylacetic acid
CAS:4-Ethoxy-3-methoxyphenylacetic acidFormula:C11H14O4Purity:97%Molecular weight:210.234-Ethoxy-3-methoxyphenylacetic acid
CAS:4-Ethoxy-3-methoxyphenylacetic acid is an aromatic compound that is found in plants and fungi. It is a model compound for the oxidative decarboxylation of lignin, which generates 4-ethoxy-3-methoxyphenol and formaldehyde. The fungus Phanerochaete chrysosporium can produce this compound from hydroxyethane. This metabolic product can be metabolized further by oxidation to 4-hydroxybenzoic acid or reduction to 3,4,5-trihydroxyphenylacetic acid.Formula:C11H14O4Purity:Min. 95%Color and Shape:PowderMolecular weight:210.23 g/mol4-Ethoxy-3-methoxyphenylacetic acid
CAS:Formula:C11H14O4Purity:97%Color and Shape:SolidMolecular weight:210.229




