CymitQuimica logo

CAS 120121-07-5

:

5-FLUORO-2-MERCAPTOBENZOIC ACID

Description:
5-Fluoro-2-mercaptobenzoic acid is an organic compound characterized by the presence of a fluorine atom and a thiol (-SH) group attached to a benzoic acid structure. Its molecular formula typically includes a benzene ring substituted with a carboxylic acid group (-COOH) and a mercapto group, which contributes to its reactivity and potential applications in various chemical reactions. The fluorine substitution can influence the compound's electronic properties, making it useful in medicinal chemistry and as a building block in the synthesis of more complex molecules. The thiol group imparts unique characteristics, such as the ability to form disulfide bonds and participate in redox reactions. This compound may exhibit moderate solubility in polar solvents and can be sensitive to air and moisture, necessitating careful handling and storage. Its CAS number, 120121-07-5, allows for precise identification in chemical databases and literature. Overall, 5-fluoro-2-mercaptobenzoic acid is of interest in research fields such as pharmaceuticals and materials science due to its functional groups and structural features.
Formula:C7H5FO2S
InChI:InChI=1/C7H5FO2S/c8-4-1-2-6(11)5(3-4)7(9)10/h1-3,11H,(H,9,10)
InChI key:InChIKey=WSOZOINWBSJTER-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(S)C=CC(F)=C1
Synonyms:
  • 5-Fluoro-2-Sulfanylbenzoic Acid
  • 5-Fluoro-2-Thiobenzoic Acid
  • 5-Fluoro-2-thiobenzoic acid 98%
  • 5-Fluoro-2-thiobenzoicacid98%
  • Benzoic acid, 5-fluoro-2-mercapto-
  • 5-Fluoro-2-mercaptobenzoic acid
  • 5-Fluoro-2-mercaptobenzoic acid, 5-Fluoro-2-sulphanylbenzoic acid
  • 5-fluoro-2-sulfanylbenzoicaci
  • 5-Fluoro-2-thiobenzoic
Found 3 products.