CAS 120128-20-3
:2-[[4-[[2-(2H-Tetrazol-5-ylmethyl)phenyl]methoxy]phenoxy]methyl]quinoline
Description:
2-[[4-[[2-(2H-Tetrazol-5-ylmethyl)phenyl]methoxy]phenoxy]methyl]quinoline, identified by its CAS number 120128-20-3, is a complex organic compound characterized by its unique structural features, including a quinoline core and a tetrazole moiety. This compound typically exhibits properties associated with both quinoline derivatives and tetrazole-containing compounds, such as potential biological activity and solubility in organic solvents. The presence of multiple aromatic rings suggests that it may have significant π-π stacking interactions, which can influence its behavior in biological systems. Additionally, the tetrazole group may contribute to its pharmacological properties, as tetrazoles are known for their ability to act as bioisosteres for carboxylic acids. The compound's synthesis and characterization would involve standard organic chemistry techniques, and its applications could range from medicinal chemistry to materials science, depending on its specific interactions and reactivity. Overall, this compound represents a fascinating area of study within the field of organic and medicinal chemistry.
Formula:C25H21N5O2
InChI:InChI=1S/C25H21N5O2/c1-2-7-20(19(6-1)15-25-27-29-30-28-25)16-31-22-11-13-23(14-12-22)32-17-21-10-9-18-5-3-4-8-24(18)26-21/h1-14H,15-17H2,(H,27,28,29,30)
InChI key:InChIKey=JELDFLOBXROBFH-UHFFFAOYSA-N
SMILES:C(OC1=CC=C(OCC2=C(CC=3NN=NN3)C=CC=C2)C=C1)C4=NC5=C(C=C4)C=CC=C5
Synonyms:- 2-[(4-{[2-(2H-tetrazol-5-ylmethyl)benzyl]oxy}phenoxy)methyl]quinoline
- 2-[[4-[[2-(2H-Tetrazol-5-ylmethyl)phenyl]methoxy]phenoxy]methyl]quinoline
- Nid 525
- Quinoline, 2-[[4-[[2-(1H-tetrazol-5-ylmethyl)phenyl]methoxy]phenoxy]methyl]-
- Quinoline, 2-[[4-[[2-(2H-tetrazol-5-ylmethyl)phenyl]methoxy]phenoxy]methyl]-
- Rg-12525
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Quinoline, 2-[[4-[[2-(2H-tetrazol-5-ylmethyl)phenyl]methoxy]phenoxy]methyl]-
CAS:Formula:C25H21N5O2Purity:98.39%Molecular weight:423.4665RG-12525
CAS:RG-12525 is an engineered compound designed for targeted genetic modification, which is synthesized from recombinant DNA technology. With precise gene-editing capabilities, it utilizes CRISPR-Cas9 as its mode of action, enabling specific gene sequences to be accurately cut and modified within a variety of eukaryotic cells. The compound's mechanism involves guiding RNA that pairs with target DNA sequences, allowing the Cas9 enzyme to introduce double-strand breaks, which facilitate desired genetic alterations through cellular repair pathways.Formula:C25H21N5O2Purity:Min. 95%Molecular weight:423.5 g/molRG-12525
CAS:RG-12525(NID 525) is an orally available, selective and competitive leukotriene D (LTD) antagonist that inhibits LTC4, LTD4 and LTE4-induced contraction ofFormula:C25H21N5O2Purity:95.49%Color and Shape:SolidMolecular weight:423.47



