CAS 120156-44-7
:NICKEL(II) ACETYLACETONATE HYDRATE
Description:
Nickel(II) acetylacetonate hydrate, with the CAS number 120156-44-7, is a coordination compound of nickel characterized by its coordination with acetylacetone ligands and the presence of water molecules in its structure. This compound typically appears as a green or blue-green solid and is known for its solubility in organic solvents such as ethanol and acetone, while being less soluble in water. The nickel ion in this compound is in the +2 oxidation state, and the acetylacetonate ligands act as bidentate ligands, coordinating through their oxygen atoms. Nickel(II) acetylacetonate hydrate is often used in various applications, including catalysis, as a precursor for nickel-containing materials, and in organic synthesis. Its thermal stability allows it to be used in high-temperature processes. Additionally, it exhibits paramagnetic properties due to the presence of unpaired electrons in the nickel ion, making it of interest in studies related to magnetism and electronic properties. Safety precautions should be taken when handling this compound, as nickel compounds can be toxic and may pose health risks.
Formula:C10H16NiO5
Synonyms:- Nickel(Ii) 2,4-Pentanedionate Hydrate
- Nickel Acetylacetonate Hydrate
- Bis(2,4-Pentanedionato)Nickel(Ii) Hydrate
- Acetylacetone Nickel(Ii) Salt Hydrate
- Nickel(II) 2,4-pentanedioate hydrate
- Bis(Acetylacetonato)Nickel(Ii) Hydrate
- Nickel(Ii) 2,4-Pentanedionate Dihydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Bis(2,4-pentanedionato)nickel(II) Hydrate
CAS:Formula:C10H14NiO4·xH2OPurity:>85.0%(T)Color and Shape:White to Dark green to Dark purple powder to crystalMolecular weight:256.91 (as Anhydrous)Nickel (II) Acetylacetonate Hydrate
CAS:Nickel (II) Acetylacetonate HydrateFormula:C10H14NiO4·H2OPurity:98%Molecular weight:274.924Bis(2,4-pentanedionato)nickel(II)
CAS:Controlled ProductApplications Bis(2,4-pentanedionato)nickel(II) (cas# 120156-44-7) is a useful research chemical.
Formula:C5H8O2·H2O·NiColor and Shape:NeatMolecular weight:276.94Nickel(II) acetylacetonate hydrate
CAS:Nickel(II) acetylacetonate hydrate
Formula:Ni(CH3COCHCOCH3)2·XH2OColor and Shape:light green pwdr.Molecular weight:256.93Acetylacetone nickel(ii) salt hydrate
CAS:Formula:C10H16NiO5Purity:85.0%Color and Shape:SolidMolecular weight:274.9244Ref: IN-DA000QF6
Discontinued product





