CAS 120164-49-0

6-Hydroxy-4,5,7-trimethyl-2-(4-sulfamoylbenzylamino)benzothiazole hydrochloride

Description:

6-Hydroxy-4,5,7-trimethyl-2-(4-sulfamoylbenzylamino)benzothiazole hydrochloride is a chemical compound characterized by its complex structure, which includes a benzothiazole core substituted with various functional groups. The presence of hydroxyl, sulfonamide, and multiple methyl groups contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar solvents, which is common for many sulfonamide derivatives. Its hydrochloride form indicates that it is a salt, enhancing its stability and solubility in aqueous solutions. The sulfonamide group suggests potential biological activity, often associated with antibacterial properties, while the benzothiazole moiety is known for its applications in pharmaceuticals and dyes. The compound's specific interactions and reactivity can be influenced by the arrangement of its substituents, making it of interest in medicinal chemistry and drug development. As with any chemical, proper handling and safety measures should be observed due to potential toxicity or reactivity.

Formula: C₁₇H₂₀ClN₃O₃S₂

InChI: InChI=1/C17H19N3O3S2.ClH/c1-9-10(2)15(21)11(3)16-14(9)20-17(24-16)19-8-12-4-6-13(7-5-12)25(18,22)23;/h4-7,21H,8H2,1-3H3,(H,19,20)(H2,18,22,23);1H

InChI key: WLODMDLNSQYBMG-UHFFFAOYSA-N

SMILES: CC1=C(C(=C(C2=C1N=C(S2)NCC3=CC=C(C=C3)S(=O)(=O)N)C)O)C.Cl

Synonyms:

• 4-[[(6-Hydroxy-4,5,7-trimethyl-2-benzothiazolyl)amino]methyl]benzenesulfonamide hydrochloride
• E-6080
• 4-{[(6-hydroxy-4,5,7-trimethyl-1,3-benzothiazol-2-yl)amino]methyl}benzenesulfonamide hydrochloride (1:1)

E 6080 HCl

CAS: 120164-49-0

E 6080 HCl

Formula: C₁₇H₂₀ClN₃O₃S₂

Purity: ≥98%

Molecular weight: 413.94

Ref: 54-BUP00448

E 6080 HCl

CAS: 120164-49-0

E 6080 HCl is a 5-lipoxygenase inhibitor and can be used to study bronchial diseases.

Formula: C₁₇H₂₀ClN₃O₃S₂

Purity: 99.78%

Color and Shape: White Solid

Molecular weight: 413.94

Ref: TM-T10508L

E 6080 HCl

CAS: 120164-49-0

Molecular weight: G/Mol

Ref: IN-DA024AWH