CAS 1202-39-7
:3,4-Dichlorocinnamic acid
Description:
3,4-Dichlorocinnamic acid is an organic compound characterized by its aromatic structure and the presence of two chlorine substituents on the cinnamic acid backbone. It features a trans configuration, which is significant for its biological activity and stability. The compound is typically a white to off-white crystalline solid, exhibiting moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water. Its molecular formula is C9H6Cl2O2, and it has a molecular weight that reflects the presence of the chlorine atoms. 3,4-Dichlorocinnamic acid is known for its potential applications in pharmaceuticals and as an intermediate in organic synthesis. It may exhibit biological activities, including anti-inflammatory and antimicrobial properties, making it of interest in medicinal chemistry. Additionally, the presence of the chlorine atoms can influence its reactivity and interaction with biological targets. Proper handling and safety measures are essential due to its chemical nature and potential toxicity.
Formula:C9H6Cl2O2
InChI:InChI=1S/C9H6Cl2O2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5H,(H,12,13)
InChI key:InChIKey=RRLUFPHCTSFKNR-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C1=CC(Cl)=C(Cl)C=C1
Synonyms:- (2E)-3-(3,4-dichlorophenyl)prop-2-enoic acid
- 2-Propenoic acid, 3-(3,4-dichlorophenyl)-
- 3',4'-Dichlorocinnamic acid
- 3-(3,4-Dichlorophenyl)-2-propenoic acid
- 3-(3,4-Dichlorophenyl)Prop-2-Enoic Acid
- 3-(3,4-Dichlorophenyl)acrylic acid
- Brn 1872129
- Cinnamic acid, 3,4-dichloro-
- Nsc 518800
- Unii-480625A7Sy
- 3,4-Dichlorocinnamic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,4-Dichlorocinnamic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H6Cl2O2Purity:97%Color and Shape:White, PowderMolecular weight:217.05(E)-3-(3,4-Dichlorophenyl)acrylic acid
CAS:Formula:C9H6Cl2O2Purity:95%Color and Shape:SolidMolecular weight:217.04873,4-Dichlorocinnamic acid
CAS:3,4-Dichlorocinnamic acidFormula:C9H6Cl2O2Purity:≥95%Color and Shape: white. crystalline solidMolecular weight:217.05g/mol3,4-Dichlorocinnamic acid
CAS:3,4-Dichlorocinnamic acid is a pentane that has a molecular weight of 144.2 g/mol and melting point of -12 °C. It is soluble in organic solvents such as ethanol and acetone, but insoluble in water. 3,4-Dichlorocinnamic acid is an intermediate in the synthesis of cinnamates from phenylacetic acid and chloroform via methyl esterification with methanol followed by alkylation with chlorine. The reaction rate for this conversion is slow, making it difficult to produce at commercial scale. 3,4-Dichlorocinnamic acid can be obtained by irradiation of 3-chloro-1,2-propanediol with ultraviolet light or by heating hydrotalcite at high temperatures. Hydrotalcite is heated to 600°C where it reacts with air to form 3,4-dichlorocinnamic acid and
Formula:C9H6Cl2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:217.05 g/mol




