CAS 1202-39-7
:3,4-Dichlorocinnamic acid
Description:
3,4-Dichlorocinnamic acid is an organic compound characterized by its aromatic structure and the presence of two chlorine substituents on the cinnamic acid backbone. It features a trans configuration, which is significant for its biological activity and stability. The compound is typically a white to off-white crystalline solid, exhibiting moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water. Its molecular formula is C9H6Cl2O2, and it has a molecular weight that reflects the presence of the chlorine atoms. 3,4-Dichlorocinnamic acid is known for its potential applications in pharmaceuticals and as an intermediate in organic synthesis. It may exhibit biological activities, including anti-inflammatory and antimicrobial properties, making it of interest in medicinal chemistry. Additionally, the presence of the chlorine atoms can influence its reactivity and interaction with biological targets. Proper handling and safety measures are essential due to its chemical nature and potential toxicity.
Formula:C9H6Cl2O2
InChI:InChI=1S/C9H6Cl2O2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5H,(H,12,13)
InChI key:InChIKey=RRLUFPHCTSFKNR-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C1=CC(Cl)=C(Cl)C=C1
Synonyms:- (2E)-3-(3,4-dichlorophenyl)prop-2-enoic acid
- 2-Propenoic acid, 3-(3,4-dichlorophenyl)-
- 3',4'-Dichlorocinnamic acid
- 3-(3,4-Dichlorophenyl)-2-propenoic acid
- 3-(3,4-Dichlorophenyl)Prop-2-Enoic Acid
- 3-(3,4-Dichlorophenyl)acrylic acid
- Brn 1872129
- Cinnamic acid, 3,4-dichloro-
- Nsc 518800
- Unii-480625A7Sy
- 3,4-Dichlorocinnamic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,4-Dichlorocinnamic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H6Cl2O2Purity:97%Color and Shape:White, PowderMolecular weight:217.053,4-Dichlorocinnamic acid
CAS:3,4-Dichlorocinnamic acidFormula:C9H6Cl2O2Purity:≥95%Color and Shape:White Solid-PowderMolecular weight:217.048743,4-Dichlorocinnamic Acid
CAS:Formula:C9H6Cl2O2Purity:95%Color and Shape:SolidMolecular weight:217.04873,4-Dichlorocinnamic Acid
CAS:3,4-Dichlorocinnamic AcidFormula:C9H6Cl2O2Purity:97% (E)Molecular weight:217.05




