CymitQuimica logo

CAS 1203181-56-9

:

3-bromo-1-methyl-1H-indazol-6-amine

Description:
3-Bromo-1-methyl-1H-indazol-6-amine is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromine atom at the 3-position and a methyl group at the 1-position contributes to its unique reactivity and properties. The amine functional group at the 6-position enhances its potential for hydrogen bonding and increases its solubility in polar solvents. This compound is often studied for its biological activity, particularly in medicinal chemistry, where it may exhibit properties such as anti-cancer or anti-inflammatory effects. Its molecular structure allows for various synthetic modifications, making it a valuable intermediate in the development of pharmaceuticals. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the bromine and methyl substituents, which can affect its interactions with biological targets. Overall, 3-bromo-1-methyl-1H-indazol-6-amine is a significant compound in research, particularly in the fields of organic and medicinal chemistry.
Formula:C8H8BrN3
InChI:InChI=1S/C8H8BrN3/c1-12-7-4-5(10)2-3-6(7)8(9)11-12/h2-4H,10H2,1H3
InChI key:JVIGJNCYOXHIBK-UHFFFAOYSA-N
SMILES:CN1C2=C(C=CC(=C2)N)C(=N1)Br
Found 5 products.