CymitQuimica logo

CAS 1204144-28-4

:

AZD-1208

Description:
AZD-1208 is a small molecule inhibitor primarily targeting the protein kinase activity of the enzyme PIM (Proviral Integration site for Moloney murine leukemia virus). It has been investigated for its potential therapeutic applications in oncology, particularly in the treatment of various cancers where PIM kinases are implicated in tumor growth and survival. AZD-1208 exhibits characteristics typical of kinase inhibitors, including the ability to disrupt signaling pathways that promote cell proliferation and inhibit apoptosis. Its chemical structure includes specific functional groups that facilitate binding to the ATP-binding site of PIM kinases, thereby inhibiting their activity. The compound has undergone preclinical studies to evaluate its efficacy and safety profile, showing promise in combination therapies. As with many investigational drugs, its pharmacokinetics, bioavailability, and metabolic pathways are critical areas of research to determine optimal dosing regimens and potential side effects. Overall, AZD-1208 represents a targeted approach in cancer therapy, focusing on the modulation of specific signaling pathways to achieve therapeutic benefits.
Formula:C21H21N3O2S
InChI:InChI=1S/C21H21N3O2S/c22-16-9-5-11-24(13-16)19-15(12-18-20(25)23-21(26)27-18)8-4-10-17(19)14-6-2-1-3-7-14/h1-4,6-8,10,12,16H,5,9,11,13,22H2,(H,23,25,26)/b18-12-/t16-/m1/s1
InChI key:MCUJKPPARUPFJM-UWCCDQBKSA-N
SMILES:C1C[C@H](CN(C1)C2=C(C=CC=C2C3=CC=CC=C3)/C=C\4/C(=O)NC(=O)S4)N
Found 11 products.