CymitQuimica logo

CAS 1204810-58-1

:

4-Piperidinamine, N-[(4-aminophenyl)methyl]-1-methyl-, hydrochloride (1:2)

Description:
4-Piperidinamine, N-[(4-aminophenyl)methyl]-1-methyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features an amino group and a methyl group attached to the piperidine, as well as a phenyl group substituted with an amino group, indicating potential biological activity. The hydrochloride salt form suggests enhanced solubility in water, making it suitable for various applications, including pharmaceutical formulations. The presence of multiple amine functionalities may contribute to its reactivity and interaction with biological targets, potentially influencing its pharmacological properties. As with many amine-containing compounds, it may exhibit basicity, allowing it to participate in acid-base reactions. Safety and handling precautions are essential due to the potential for toxicity and reactivity associated with amines. Overall, this compound's unique structure and properties make it of interest in medicinal chemistry and drug development.
Formula:C13H21N3·2ClH
InChI:InChI=1S/C13H21N3.2ClH/c1-16-8-6-13(7-9-16)15-10-11-2-4-12(14)5-3-11;;/h2-5,13,15H,6-10,14H2,1H3;2*1H
InChI key:InChIKey=GJALORLKAMCPMC-UHFFFAOYSA-N
SMILES:C(NC1CCN(C)CC1)C2=CC=C(N)C=C2.Cl
Synonyms:
  • 4-Piperidinamine, N-[(4-aminophenyl)methyl]-1-methyl-, hydrochloride (1:2)
Found 1 products.