CAS 12062-13-4

Niobate(1-), hexafluoro-, ammonium (1:1), (OC-6-11)-

Description:

Niobate(1-), hexafluoro-, ammonium (1:1), (OC-6-11)-, with the CAS number 12062-13-4, is a chemical compound that features niobium in a negative oxidation state, specifically as a niobate ion. This compound is characterized by the presence of hexafluoro groups, which contribute to its unique chemical properties, including high stability and potential reactivity in various chemical environments. The ammonium component indicates that it can form ionic bonds, enhancing its solubility in polar solvents. The notation (OC-6-11) suggests that the compound may have a specific organic chain or substituent, which can influence its physical properties, such as hydrophobicity or interaction with other molecules. Overall, this compound is of interest in materials science and chemistry due to its potential applications in electronics, catalysis, and as a precursor in the synthesis of other niobium-containing materials. Its unique structural characteristics make it a subject of study for researchers exploring advanced materials and chemical reactivity.

Formula: F₆Nb·H₄N

InChI: InChI=1S/6FH.H3N.Nb/h6*1H;1H3;/q;;;;;;;+5/p-5

InChI key: InChIKey=SKIHFCFFRXCIJA-UHFFFAOYSA-I

SMILES: [Nb+5]([F-])([F-])([F-])([F-])([F-])[F-].[NH4+]

Synonyms:

• Niobate(1-), hexafluoro-, ammonium (1:1), (OC-6-11)-
• Niobate(1-), hexafluoro-, ammonium, (OC-6-11)-
• Niobate(1-), hexafluoro-, ammonium
• Ammonium fluoniobate(V)
• Ammonium hexafluoroniobate(V)

Ammonium Hexafluoroniobate

CAS: 12062-13-4

Ammonium hexafluoroniobate is an organosilicon compound that does not react with water and is used as a solvent for other organics. It can be activated to form a reactive surface by treatment with a metal such as copper or aluminum, which can then be used in the treatment of metals. Ammonium hexafluoroniobate has been used as a diagnostic agent and diagnostic reagent in various reactions at different temperatures. It has also been used as the photoreceptor in electrophotographic printing processes, where it is exposed to light-sensitive material and then developed using organic solvents.

Formula: F₆H₄NNb

Purity: Min. 95%

Molecular weight: 224.94 g/mol

Ref: 3D-FA78203