CymitQuimica logo

CAS 1206981-17-0

:

2-Indolizinecarboxylic acid, 8-chloro-

Description:
2-Indolizinecarboxylic acid, 8-chloro- is a chemical compound characterized by its indolizine structure, which is a bicyclic compound featuring a five-membered nitrogen-containing ring fused to a six-membered carbon ring. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, participating in various chemical reactions, including esterification and amidation. The chloro substituent at the 8-position introduces additional reactivity and can influence the compound's biological activity and solubility. This compound may exhibit properties relevant to medicinal chemistry, potentially serving as a scaffold for drug development. Its molecular structure suggests it could interact with biological targets, making it of interest in pharmacological research. Additionally, the compound's stability, solubility, and reactivity can be influenced by the presence of the chloro group and the carboxylic acid moiety, which may affect its applications in various chemical and biological contexts. Overall, 2-Indolizinecarboxylic acid, 8-chloro- is a compound with potential utility in both synthetic and medicinal chemistry.
Formula:C9H6ClNO2
InChI:InChI=1S/C9H6ClNO2/c10-7-2-1-3-11-5-6(9(12)13)4-8(7)11/h1-5H,(H,12,13)
InChI key:AYNHSPFBVUZHEF-UHFFFAOYSA-N
SMILES:C1=CN2C=C(C=C2C(=C1)Cl)C(=O)O
Synonyms:
  • 2-Indolizinecarboxylic acid, 8-chloro-
Found 3 products.