CymitQuimica logo

CAS 1207-72-3

:

10-Methylphenothiazine

Description:
10-Methylphenothiazine is an organic compound belonging to the phenothiazine family, characterized by its fused three-ring structure that includes a sulfur atom and a nitrogen atom within the central ring. This compound typically exhibits a pale yellow to light brown appearance and is known for its aromatic properties, which contribute to its potential applications in various fields, including pharmaceuticals and dyes. The presence of the methyl group at the 10-position influences its chemical reactivity and solubility, making it a subject of interest in medicinal chemistry. 10-Methylphenothiazine can participate in various chemical reactions, including oxidation and substitution reactions, and may exhibit biological activity, such as antimicrobial or antipsychotic effects, similar to other phenothiazine derivatives. Its stability and reactivity can be affected by environmental factors such as light and temperature. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C13H11NS
InChI:InChI=1S/C13H11NS/c1-14-10-6-2-4-8-12(10)15-13-9-5-3-7-11(13)14/h2-9H,1H3
InChI key:InChIKey=QXBUYALKJGBACG-UHFFFAOYSA-N
SMILES:CN1C=2C(SC=3C1=CC=CC3)=CC=CC2
Synonyms:
  • 10-Methylphenothiazine
  • N-Methylphenothiazine
  • 10-Methyl-10H-phenothiazine
  • Phenothiazine, 10-methyl-
  • 10H-Phenothiazine, 10-methyl-
Found 7 products.